C31H29NO2 — CID 135014176
ethyl (2R,3R)-1-benzhydryl-2-benzyl-3-phenylaziridine-2-carboxylate (PubChem CID 135014176) has the molecular formula C31H29NO2 and a molecular weight of 447.58 g/mol. Its IUPAC name is ethyl (2R,3R)-1-benzhydryl-2-benzyl-3-phenylaziridine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-benzhydryl-2-benzyl-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 135014176 |
| Molecular Formula | C31H29NO2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | ethyl (2R,3R)-1-benzhydryl-2-benzyl-3-phenylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccccc2)[C@@H](c2ccccc2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29NO2/c1-2-34-30(33)31(23-24-15-7-3-8-16-24)29(27-21-13-6-14-22-27)32(31)28(25-17-9-4-10-18-25)26-19-11-5-12-20-26/h3-22,28-29H,2,23H2,1H3/t29-,31-,32?/m1/s1 |
| InChIKey | AMYICYRFWNZWOC-KVZOJTFESA-N |
| XLogP | 6.38 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|