C21H40O4Si2 — CID 135014185
methyl (1R,4S,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]bicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 135014185) has the molecular formula C21H40O4Si2 and a molecular weight of 412.72 g/mol. Its IUPAC name is methyl (1R,4S,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]bicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | methyl (1R,4S,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]bicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 135014185 |
| Molecular Formula | C21H40O4Si2 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | methyl (1R,4S,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]bicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si2/c1-20(2,3)26(8,9)24-17-15-12-14(15)13-16(19(22)23-7)18(17)25-27(10,11)21(4,5)6/h13-15,17-18H,12H2,1-11H3/t14-,15-,17+,18+/m1/s1 |
| InChIKey | ZBYXMCUPPXMNGW-LMSBXDPUSA-N |
| XLogP | 5.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|