C12H12N2O3S — CID 1350142
(5Z)-2-amino-5-[(3,5-dimethoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 1350142) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is (5Z)-2-amino-5-[(3,5-dimethoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[(3,5-dimethoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 1350142 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (5Z)-2-amino-5-[(3,5-dimethoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2\SC(N)=NC2=O)cc(OC)c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-16-8-3-7(4-9(6-8)17-2)5-10-11(15)14-12(13)18-10/h3-6H,1-2H3,(H2,13,14,15)/b10-5- |
| InChIKey | PTRJKBPNFGCUAW-YHYXMXQVSA-N |
| XLogP | 1.63 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|