C15H21ClO3 — CID 135014258
(3aS,7aS)-3a-chloro-2-(5,5-dimethyl-1,3-dioxan-2-ylidene)-1,3,5,6,7,7a-hexahydroinden-4-one (PubChem CID 135014258) has the molecular formula C15H21ClO3 and a molecular weight of 284.78 g/mol. Its IUPAC name is (3aS,7aS)-3a-chloro-2-(5,5-dimethyl-1,3-dioxan-2-ylidene)-1,3,5,6,7,7a-hexahydroinden-4-one.
| Compound Name | (3aS,7aS)-3a-chloro-2-(5,5-dimethyl-1,3-dioxan-2-ylidene)-1,3,5,6,7,7a-hexahydroinden-4-one |
|---|---|
| PubChem CID | 135014258 |
| Molecular Formula | C15H21ClO3 |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (3aS,7aS)-3a-chloro-2-(5,5-dimethyl-1,3-dioxan-2-ylidene)-1,3,5,6,7,7a-hexahydroinden-4-one |
| SMILES | CC1(C)COC(=C2C[C@@H]3CCCC(=O)[C@]3(Cl)C2)OC1 |
| InChI | InChI=1S/C15H21ClO3/c1-14(2)8-18-13(19-9-14)10-6-11-4-3-5-12(17)15(11,16)7-10/h11H,3-9H2,1-2H3/t11-,15-/m0/s1 |
| InChIKey | ZPWWMEAASRPPBM-NHYWBVRUSA-N |
| XLogP | 3.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|