About tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane
tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane (PubChem CID 135014391) has the molecular formula C21H46O2Si2
and a molecular weight of 386.77 g/mol. Its IUPAC name is tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane |
| PubChem CID | 135014391 |
| Molecular Formula | C21H46O2Si2 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](C[C@@H](CCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H46O2Si2/c1-13-15-18(22-24(9,10)20(3,4)5)17-19(16-14-2)23-25(11,12)21(6,7)8/h13,18-19H,1,14-17H2,2-12H3/t18-,19-/m1/s1 |
| InChIKey | LTWMHMINJIHZNV-RTBURBONSA-N |
| XLogP | 7.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane (CID 135014391) is tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane is C=CC[C@H](C[C@@H](CCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane?
The InChIKey is LTWMHMINJIHZNV-RTBURBONSA-N. The full InChI is InChI=1S/C21H46O2Si2/c1-13-15-18(22-24(9,10)20(3,4)5)17-19(16-14-2)23-25(11,12)21(6,7)8/h13,18-19H,1,14-17H2,2-12H3/t18-,19-/m1/s1.
What are the key properties of tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane?
tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane has a molecular weight of 386.77 g/mol, XLogP of 7.53, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxynon-8-en-4-yl]oxy-dimethylsilane is sourced from PubChem (CID 135014391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).