C23H28N2O7 — CID 135014417
benzyl N-[1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 135014417) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is benzyl N-[1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 135014417 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | benzyl N-[1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyethyl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | CC1(C)OC[C@H](C(CO)N(NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C23H28N2O7/c1-23(2)31-16-20(32-23)19(13-26)25(22(28)30-15-18-11-7-4-8-12-18)24-21(27)29-14-17-9-5-3-6-10-17/h3-12,19-20,26H,13-16H2,1-2H3,(H,24,27)/t19?,20-/m1/s1 |
| InChIKey | JTAQKXSHVNWFPL-GFOWMXPYSA-N |
| XLogP | 2.98 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|