About trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane
trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane (PubChem CID 135014432) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane.
Molecular Properties
| Compound Name | trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane |
| PubChem CID | 135014432 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane |
| SMILES | C=C[C@H]1CC(C)(C)C[C@@H]1CCC(=C)C |
| InChI | InChI=1S/C14H24/c1-6-12-9-14(4,5)10-13(12)8-7-11(2)3/h6,12-13H,1-2,7-10H2,3-5H3/t12-,13-/m0/s1 |
| InChIKey | IUXJPHXXDVCISZ-STQMWFEESA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane?
The IUPAC name of trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane (CID 135014432) is trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane.
What is the SMILES notation for trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane?
The canonical SMILES for trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane is C=C[C@H]1CC(C)(C)C[C@@H]1CCC(=C)C.
What is the InChIKey of trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane?
The InChIKey is IUXJPHXXDVCISZ-STQMWFEESA-N. The full InChI is InChI=1S/C14H24/c1-6-12-9-14(4,5)10-13(12)8-7-11(2)3/h6,12-13H,1-2,7-10H2,3-5H3/t12-,13-/m0/s1.
What are the key properties of trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane?
trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane has a molecular weight of 192.35 g/mol, XLogP of 4.58, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3R,4S)-3-ethenyl-1,1-dimethyl-4-(3-methylbut-3-enyl)cyclopentane is sourced from PubChem (CID 135014432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).