C18H27NO5 — CID 135014550
(2R,3R)-2,3-dihydroxy-N,N-dimethyl-4-oxo-9-phenylmethoxynonanamide (PubChem CID 135014550) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-N,N-dimethyl-4-oxo-9-phenylmethoxynonanamide.
| Compound Name | (2R,3R)-2,3-dihydroxy-N,N-dimethyl-4-oxo-9-phenylmethoxynonanamide |
|---|---|
| PubChem CID | 135014550 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-N,N-dimethyl-4-oxo-9-phenylmethoxynonanamide |
| SMILES | CN(C)C(=O)[C@H](O)[C@@H](O)C(=O)CCCCCOCc1ccccc1 |
| InChI | InChI=1S/C18H27NO5/c1-19(2)18(23)17(22)16(21)15(20)11-7-4-8-12-24-13-14-9-5-3-6-10-14/h3,5-6,9-10,16-17,21-22H,4,7-8,11-13H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | OWQZQNVBTKWJFX-DLBZAZTESA-N |
| XLogP | 1.14 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|