C32H70O5Si3 — CID 135014563
[(2R)-7-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]heptan-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 135014563) has the molecular formula C32H70O5Si3 and a molecular weight of 619.17 g/mol. Its IUPAC name is [(2R)-7-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]heptan-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R)-7-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]heptan-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135014563 |
| Molecular Formula | C32H70O5Si3 |
| Molecular Weight | 619.17 g/mol |
| Exact Mass | 618.45 |
| IUPAC Name | [(2R)-7-[(4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]heptan-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](CCCCC[C@@H]1OC(C)(C)O[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H70O5Si3/c1-25(36-39(15,16)30(5,6)7)22-20-19-21-23-26-28(35-32(11,12)34-26)27(37-40(17,18)31(8,9)10)24-33-38(13,14)29(2,3)4/h25-28H,19-24H2,1-18H3/t25-,26+,27-,28+/m1/s1 |
| InChIKey | NUHYVFPGWVTXNS-GCFVYEKYSA-N |
| XLogP | 10.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.17 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|