About (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol
(2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol (PubChem CID 135014704) has the molecular formula C12H28O3Si
and a molecular weight of 248.44 g/mol. Its IUPAC name is (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol.
Molecular Properties
| Compound Name | (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol |
| PubChem CID | 135014704 |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol |
| SMILES | C[C@H](CC[C@@H](O)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O3Si/c1-10(7-8-11(14)9-13)15-16(5,6)12(2,3)4/h10-11,13-14H,7-9H2,1-6H3/t10-,11-/m1/s1 |
| InChIKey | BHONTVONWSWCMW-GHMZBOCLSA-N |
| XLogP | 2.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol?
The IUPAC name of (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol (CID 135014704) is (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol.
What is the SMILES notation for (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol?
The canonical SMILES for (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol is C[C@H](CC[C@@H](O)CO)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol?
The InChIKey is BHONTVONWSWCMW-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H28O3Si/c1-10(7-8-11(14)9-13)15-16(5,6)12(2,3)4/h10-11,13-14H,7-9H2,1-6H3/t10-,11-/m1/s1.
What are the key properties of (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol?
(2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol has a molecular weight of 248.44 g/mol, XLogP of 2.53, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol is sourced from PubChem (CID 135014704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).