About (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one
(5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one (PubChem CID 135014768) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one |
| PubChem CID | 135014768 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one |
| SMILES | CCO[C@@]1(C)CC=C(C)C1=O |
| InChI | InChI=1S/C9H14O2/c1-4-11-9(3)6-5-7(2)8(9)10/h5H,4,6H2,1-3H3/t9-/m0/s1 |
| InChIKey | REDJYNSJODELFH-VIFPVBQESA-N |
| XLogP | 1.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one?
The IUPAC name of (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one (CID 135014768) is (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one.
What is the SMILES notation for (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one?
The canonical SMILES for (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one is CCO[C@@]1(C)CC=C(C)C1=O.
What is the InChIKey of (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one?
The InChIKey is REDJYNSJODELFH-VIFPVBQESA-N. The full InChI is InChI=1S/C9H14O2/c1-4-11-9(3)6-5-7(2)8(9)10/h5H,4,6H2,1-3H3/t9-/m0/s1.
What are the key properties of (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one?
(5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one has a molecular weight of 154.21 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-ethoxy-2,5-dimethylcyclopent-2-en-1-one is sourced from PubChem (CID 135014768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).