C13H18O7 — CID 135014820
methyl 2-[(2R,3R,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 135014820) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is methyl 2-[(2R,3R,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 135014820 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl 2-[(2R,3R,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@H]1C=C[C@@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C13H18O7/c1-8(14)18-7-12-11(19-9(2)15)5-4-10(20-12)6-13(16)17-3/h4-5,10-12H,6-7H2,1-3H3/t10-,11-,12-/m1/s1 |
| InChIKey | DEQRIBGRPRSIKA-IJLUTSLNSA-N |
| XLogP | 0.37 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|