C14H28NO+ — CID 135014867
3-(3-ethoxybuta-1,3-dien-2-yl)octan-2-ylazanium (PubChem CID 135014867) has the molecular formula C14H28NO+ and a molecular weight of 226.38 g/mol. Its IUPAC name is 3-(3-ethoxybuta-1,3-dien-2-yl)octan-2-ylazanium.
| Compound Name | 3-(3-ethoxybuta-1,3-dien-2-yl)octan-2-ylazanium |
|---|---|
| PubChem CID | 135014867 |
| Molecular Formula | C14H28NO+ |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 3-(3-ethoxybuta-1,3-dien-2-yl)octan-2-ylazanium |
| SMILES | C=C(OCC)C(=C)C(CCCCC)C(C)[NH3+] |
| InChI | InChI=1S/C14H27NO/c1-6-8-9-10-14(12(4)15)11(3)13(5)16-7-2/h12,14H,3,5-10,15H2,1-2,4H3/p+1 |
| InChIKey | USIMVGIVQYHSPG-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|