C16H22N2O2Si — CID 135014908
methyl 8,8-dimethyl-4,15-diaza-8-silatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5-triene-11-carboxylate (PubChem CID 135014908) has the molecular formula C16H22N2O2Si and a molecular weight of 302.45 g/mol. Its IUPAC name is methyl 8,8-dimethyl-4,15-diaza-8-silatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5-triene-11-carboxylate.
| Compound Name | methyl 8,8-dimethyl-4,15-diaza-8-silatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5-triene-11-carboxylate |
|---|---|
| PubChem CID | 135014908 |
| Molecular Formula | C16H22N2O2Si |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | methyl 8,8-dimethyl-4,15-diaza-8-silatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5-triene-11-carboxylate |
| SMILES | COC(=O)C12CCCN1C1c3cnccc3[Si](C)(C)C1C2 |
| InChI | InChI=1S/C16H22N2O2Si/c1-20-15(19)16-6-4-8-18(16)14-11-10-17-7-5-12(11)21(2,3)13(14)9-16/h5,7,10,13-14H,4,6,8-9H2,1-3H3 |
| InChIKey | YDYASDZHOXZOKW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|