C10H26N2O2Si+2 — CID 135015025
dimethoxy-methyl-[3-(3-methylimidazolidine-1,3-diium-1-yl)propyl]silane (PubChem CID 135015025) has the molecular formula C10H26N2O2Si+2 and a molecular weight of 234.42 g/mol. Its IUPAC name is dimethoxy-methyl-[3-(3-methylimidazolidine-1,3-diium-1-yl)propyl]silane.
| Compound Name | dimethoxy-methyl-[3-(3-methylimidazolidine-1,3-diium-1-yl)propyl]silane |
|---|---|
| PubChem CID | 135015025 |
| Molecular Formula | C10H26N2O2Si+2 |
| Molecular Weight | 234.42 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | dimethoxy-methyl-[3-(3-methylimidazolidine-1,3-diium-1-yl)propyl]silane |
| SMILES | CO[Si](C)(CCC[NH+]1CC[NH+](C)C1)OC |
| InChI | InChI=1S/C10H24N2O2Si/c1-11-7-8-12(10-11)6-5-9-15(4,13-2)14-3/h5-10H2,1-4H3/p+2 |
| InChIKey | DOURWXUVDGELAB-UHFFFAOYSA-P |
| XLogP | -1.89 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.42 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|