C8H9NO — CID 135015221
(2E,4Z)-4,5-dimethyl-6-oxohexa-2,4-dienenitrile (PubChem CID 135015221) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is (2E,4Z)-4,5-dimethyl-6-oxohexa-2,4-dienenitrile.
| Compound Name | (2E,4Z)-4,5-dimethyl-6-oxohexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 135015221 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | (2E,4Z)-4,5-dimethyl-6-oxohexa-2,4-dienenitrile |
| SMILES | C/C(C=O)=C(C)/C=C/C#N |
| InChI | InChI=1S/C8H9NO/c1-7(4-3-5-9)8(2)6-10/h3-4,6H,1-2H3/b4-3+,8-7- |
| InChIKey | VGIZDVGKOFSDCE-UTUPVWNLSA-N |
| XLogP | 1.60 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|