C21H44O3Si — CID 135015253
tert-butyl-[(4S,6S,9R)-4-(methoxymethoxy)-9-methyldodec-11-en-6-yl]oxy-dimethylsilane (PubChem CID 135015253) has the molecular formula C21H44O3Si and a molecular weight of 372.67 g/mol. Its IUPAC name is tert-butyl-[(4S,6S,9R)-4-(methoxymethoxy)-9-methyldodec-11-en-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,6S,9R)-4-(methoxymethoxy)-9-methyldodec-11-en-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135015253 |
| Molecular Formula | C21H44O3Si |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | tert-butyl-[(4S,6S,9R)-4-(methoxymethoxy)-9-methyldodec-11-en-6-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](C)CC[C@@H](C[C@H](CCC)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O3Si/c1-10-12-18(3)14-15-20(24-25(8,9)21(4,5)6)16-19(13-11-2)23-17-22-7/h10,18-20H,1,11-17H2,2-9H3/t18-,19-,20-/m0/s1 |
| InChIKey | IGYSRGIMVWHRJF-UFYCRDLUSA-N |
| XLogP | 6.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|