C32H43NO5S — CID 135015394
tert-butyl (2S,5S)-6-[1-(benzenesulfonyl)but-3-enyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate (PubChem CID 135015394) has the molecular formula C32H43NO5S and a molecular weight of 553.77 g/mol. Its IUPAC name is tert-butyl (2S,5S)-6-[1-(benzenesulfonyl)but-3-enyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-6-[1-(benzenesulfonyl)but-3-enyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 135015394 |
| Molecular Formula | C32H43NO5S |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | tert-butyl (2S,5S)-6-[1-(benzenesulfonyl)but-3-enyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate |
| SMILES | C=CCC(C1CCCC[C@]12CC[C@@H](COCc1ccccc1)N2C(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H43NO5S/c1-5-14-29(39(35,36)27-17-10-7-11-18-27)28-19-12-13-21-32(28)22-20-26(33(32)30(34)38-31(2,3)4)24-37-23-25-15-8-6-9-16-25/h5-11,15-18,26,28-29H,1,12-14,19-24H2,2-4H3/t26-,28?,29?,32-/m0/s1 |
| InChIKey | WYIGKXIEYGLREK-XAYBEZRUSA-N |
| XLogP | 6.95 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|