About 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine
5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine (PubChem CID 135015414) has the molecular formula C12H13N3O
and a molecular weight of 215.26 g/mol. Its IUPAC name is 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine |
| PubChem CID | 135015414 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine |
| SMILES | c1ccc(Cc2nnc(NC3CC3)o2)cc1 |
| InChI | InChI=1S/C12H13N3O/c1-2-4-9(5-3-1)8-11-14-15-12(16-11)13-10-6-7-10/h1-5,10H,6-8H2,(H,13,15) |
| InChIKey | KGMLOGYDJLOHJH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine (CID 135015414) is 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine is c1ccc(Cc2nnc(NC3CC3)o2)cc1.
What is the InChIKey of 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine?
The InChIKey is KGMLOGYDJLOHJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O/c1-2-4-9(5-3-1)8-11-14-15-12(16-11)13-10-6-7-10/h1-5,10H,6-8H2,(H,13,15).
What are the key properties of 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine?
5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine has a molecular weight of 215.26 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 135015414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).