About (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine
(4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine (PubChem CID 135015482) has the molecular formula C23H28N2S
and a molecular weight of 364.56 g/mol. Its IUPAC name is (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine.
Molecular Properties
| Compound Name | (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine |
| PubChem CID | 135015482 |
| Molecular Formula | C23H28N2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine |
| SMILES | CCCCN(CCCC)C1=Nc2ccccc2/C(=C/c2ccccc2)S1 |
| InChI | InChI=1S/C23H28N2S/c1-3-5-16-25(17-6-4-2)23-24-21-15-11-10-14-20(21)22(26-23)18-19-12-8-7-9-13-19/h7-15,18H,3-6,16-17H2,1-2H3/b22-18- |
| InChIKey | VMSIDDDNVXKAQH-PYCFMQQDSA-N |
| XLogP | 6.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine?
The IUPAC name of (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine (CID 135015482) is (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine.
What is the SMILES notation for (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine?
The canonical SMILES for (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine is CCCCN(CCCC)C1=Nc2ccccc2/C(=C/c2ccccc2)S1.
What is the InChIKey of (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine?
The InChIKey is VMSIDDDNVXKAQH-PYCFMQQDSA-N. The full InChI is InChI=1S/C23H28N2S/c1-3-5-16-25(17-6-4-2)23-24-21-15-11-10-14-20(21)22(26-23)18-19-12-8-7-9-13-19/h7-15,18H,3-6,16-17H2,1-2H3/b22-18-.
What are the key properties of (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine?
(4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine has a molecular weight of 364.56 g/mol, XLogP of 6.82, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-benzylidene-N,N-dibutyl-3,1-benzothiazin-2-amine is sourced from PubChem (CID 135015482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).