C15H12BrN3O — CID 135015503
N-benzyl-5-(3-bromophenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 135015503) has the molecular formula C15H12BrN3O and a molecular weight of 330.19 g/mol. Its IUPAC name is N-benzyl-5-(3-bromophenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-benzyl-5-(3-bromophenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 135015503 |
| Molecular Formula | C15H12BrN3O |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | N-benzyl-5-(3-bromophenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Brc1cccc(-c2nnc(NCc3ccccc3)o2)c1 |
| InChI | InChI=1S/C15H12BrN3O/c16-13-8-4-7-12(9-13)14-18-19-15(20-14)17-10-11-5-2-1-3-6-11/h1-9H,10H2,(H,17,19) |
| InChIKey | CXSMQLCYXHGJIA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |