C19H15NO4S — CID 135015567
7-methyl-3,3-dioxo-18-oxa-3λ6-thia-2-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),4(9),5,7,14(19),15,20-heptaen-17-one (PubChem CID 135015567) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is 7-methyl-3,3-dioxo-18-oxa-3λ6-thia-2-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),4(9),5,7,14(19),15,20-heptaen-17-one.
| Compound Name | 7-methyl-3,3-dioxo-18-oxa-3λ6-thia-2-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),4(9),5,7,14(19),15,20-heptaen-17-one |
|---|---|
| PubChem CID | 135015567 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 7-methyl-3,3-dioxo-18-oxa-3λ6-thia-2-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),4(9),5,7,14(19),15,20-heptaen-17-one |
| SMILES | Cc1ccc2c(c1)CC1Cc3c(ccc4oc(=O)ccc34)N1S2(=O)=O |
| InChI | InChI=1S/C19H15NO4S/c1-11-2-6-18-12(8-11)9-13-10-15-14-3-7-19(21)24-17(14)5-4-16(15)20(13)25(18,22)23/h2-8,13H,9-10H2,1H3 |
| InChIKey | OQJJVUKUFWEJGJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|