C18H13NO4S — CID 135015734
3,3-dioxo-18-oxa-3λ6-thia-2-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),4,6,8,14(19),15,20-heptaen-17-one (PubChem CID 135015734) has the molecular formula C18H13NO4S and a molecular weight of 339.37 g/mol. Its IUPAC name is 3,3-dioxo-18-oxa-3λ6-thia-2-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),4,6,8,14(19),15,20-heptaen-17-one.
| Compound Name | 3,3-dioxo-18-oxa-3λ6-thia-2-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),4,6,8,14(19),15,20-heptaen-17-one |
|---|---|
| PubChem CID | 135015734 |
| Molecular Formula | C18H13NO4S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 3,3-dioxo-18-oxa-3λ6-thia-2-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),4,6,8,14(19),15,20-heptaen-17-one |
| SMILES | O=c1ccc2c3c(ccc2o1)N1C(Cc2ccccc2S1(=O)=O)C3 |
| InChI | InChI=1S/C18H13NO4S/c20-18-8-5-13-14-10-12-9-11-3-1-2-4-17(11)24(21,22)19(12)15(14)6-7-16(13)23-18/h1-8,12H,9-10H2 |
| InChIKey | JFULUZPUPAEXOT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|