About ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate
ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate (PubChem CID 135016024) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate |
| PubChem CID | 135016024 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate |
| SMILES | C=CCN(CC=C)CC(C)(C)C(=O)OCC |
| InChI | InChI=1S/C13H23NO2/c1-6-9-14(10-7-2)11-13(4,5)12(15)16-8-3/h6-7H,1-2,8-11H2,3-5H3 |
| InChIKey | AZVLDDPGWVJZJE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate?
The IUPAC name of ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate (CID 135016024) is ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate.
What is the SMILES notation for ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate?
The canonical SMILES for ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate is C=CCN(CC=C)CC(C)(C)C(=O)OCC.
What is the InChIKey of ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate?
The InChIKey is AZVLDDPGWVJZJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-6-9-14(10-7-2)11-13(4,5)12(15)16-8-3/h6-7H,1-2,8-11H2,3-5H3.
What are the key properties of ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate?
ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate has a molecular weight of 225.33 g/mol, XLogP of 2.25, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoate is sourced from PubChem (CID 135016024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).