C17H24O12 — CID 135016152
methyl (2R)-2-[(3S)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-hydroxyacetate (PubChem CID 135016152) has the molecular formula C17H24O12 and a molecular weight of 420.37 g/mol. Its IUPAC name is methyl (2R)-2-[(3S)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-hydroxyacetate.
| Compound Name | methyl (2R)-2-[(3S)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 135016152 |
| Molecular Formula | C17H24O12 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | methyl (2R)-2-[(3S)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-hydroxyacetate |
| SMILES | COC(=O)[C@H](O)C1OC(OC)C2OC[C@H](OC(C)=O)C2(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H24O12/c1-7(18)26-10-6-25-14-16(24-5)28-12(11(21)15(22)23-4)13(27-8(2)19)17(10,14)29-9(3)20/h10-14,16,21H,6H2,1-5H3/t10-,11+,12?,13?,14?,16?,17?/m0/s1 |
| InChIKey | LXYXYKMWFJPHQF-KUPQYNPCSA-N |
| XLogP | -1.54 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|