C24H23NO — CID 135016172
(2R,6R)-4-methoxy-1,2,6-triphenyl-3,6-dihydro-2H-pyridine (PubChem CID 135016172) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is (2R,6R)-4-methoxy-1,2,6-triphenyl-3,6-dihydro-2H-pyridine.
| Compound Name | (2R,6R)-4-methoxy-1,2,6-triphenyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 135016172 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (2R,6R)-4-methoxy-1,2,6-triphenyl-3,6-dihydro-2H-pyridine |
| SMILES | COC1=C[C@H](c2ccccc2)N(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C24H23NO/c1-26-22-17-23(19-11-5-2-6-12-19)25(21-15-9-4-10-16-21)24(18-22)20-13-7-3-8-14-20/h2-17,23-24H,18H2,1H3/t23-,24-/m1/s1 |
| InChIKey | ICTZCMBJLFJMEV-DNQXCXABSA-N |
| XLogP | 5.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |