C20H34O4Si — CID 135016210
methyl (2R,2aS,4aS,7aS,7bR)-2a-[tert-butyl(dimethyl)silyl]oxy-7b-methyl-5-oxo-1,2,3,4,4a,6,7,7a-octahydrocyclobuta[e]indene-2-carboxylate (PubChem CID 135016210) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is methyl (2R,2aS,4aS,7aS,7bR)-2a-[tert-butyl(dimethyl)silyl]oxy-7b-methyl-5-oxo-1,2,3,4,4a,6,7,7a-octahydrocyclobuta[e]indene-2-carboxylate.
| Compound Name | methyl (2R,2aS,4aS,7aS,7bR)-2a-[tert-butyl(dimethyl)silyl]oxy-7b-methyl-5-oxo-1,2,3,4,4a,6,7,7a-octahydrocyclobuta[e]indene-2-carboxylate |
|---|---|
| PubChem CID | 135016210 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | methyl (2R,2aS,4aS,7aS,7bR)-2a-[tert-butyl(dimethyl)silyl]oxy-7b-methyl-5-oxo-1,2,3,4,4a,6,7,7a-octahydrocyclobuta[e]indene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(C)[C@H]3CCC(=O)[C@H]3CC[C@]12O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O4Si/c1-18(2,3)25(6,7)24-20-11-10-13-14(8-9-16(13)21)19(20,4)12-15(20)17(22)23-5/h13-15H,8-12H2,1-7H3/t13-,14-,15-,19+,20-/m0/s1 |
| InChIKey | CSYCSJJGPGFWBO-HQNIOCCESA-N |
| XLogP | 4.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|