C11H20O6 — CID 135016226
ethyl (3S,5S,6S)-6-hydroperoxy-3,5-dihydroxy-7-methyloct-7-enoate (PubChem CID 135016226) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is ethyl (3S,5S,6S)-6-hydroperoxy-3,5-dihydroxy-7-methyloct-7-enoate.
| Compound Name | ethyl (3S,5S,6S)-6-hydroperoxy-3,5-dihydroxy-7-methyloct-7-enoate |
|---|---|
| PubChem CID | 135016226 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | ethyl (3S,5S,6S)-6-hydroperoxy-3,5-dihydroxy-7-methyloct-7-enoate |
| SMILES | C=C(C)[C@H](OO)[C@@H](O)C[C@H](O)CC(=O)OCC |
| InChI | InChI=1S/C11H20O6/c1-4-16-10(14)6-8(12)5-9(13)11(17-15)7(2)3/h8-9,11-13,15H,2,4-6H2,1,3H3/t8-,9-,11-/m0/s1 |
| InChIKey | VAIRUKIGGKBMJL-QXEWZRGKSA-N |
| XLogP | 0.49 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|