C20H23N5O8 — CID 135016289
diethyl (13S,16R)-5,6-dimethyl-4-nitro-11,15-dioxo-1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3(8),4,6-triene-13,16-dicarboxylate (PubChem CID 135016289) has the molecular formula C20H23N5O8 and a molecular weight of 461.43 g/mol. Its IUPAC name is diethyl (13S,16R)-5,6-dimethyl-4-nitro-11,15-dioxo-1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3(8),4,6-triene-13,16-dicarboxylate.
| Compound Name | diethyl (13S,16R)-5,6-dimethyl-4-nitro-11,15-dioxo-1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3(8),4,6-triene-13,16-dicarboxylate |
|---|---|
| PubChem CID | 135016289 |
| Molecular Formula | C20H23N5O8 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | diethyl (13S,16R)-5,6-dimethyl-4-nitro-11,15-dioxo-1,10,12,14-tetrazatetracyclo[8.5.1.03,8.013,16]hexadeca-3(8),4,6-triene-13,16-dicarboxylate |
| SMILES | CCOC(=O)[C@@]12NC(=O)N3Cc4cc(C)c(C)c([N+](=O)[O-])c4CN(C(=O)N1)[C@]32C(=O)OCC |
| InChI | InChI=1S/C20H23N5O8/c1-5-32-15(26)19-20(16(27)33-6-2)23(17(28)21-19)8-12-7-10(3)11(4)14(25(30)31)13(12)9-24(20)18(29)22-19/h7H,5-6,8-9H2,1-4H3,(H,21,28)(H,22,29)/t19-,20+/m1/s1 |
| InChIKey | MSRFHYMZRUEAKT-UXHICEINSA-N |
| XLogP | 0.79 |
| TPSA | 160.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|