C18H38O3Si — CID 135016301
(2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldecanoic acid (PubChem CID 135016301) has the molecular formula C18H38O3Si and a molecular weight of 330.59 g/mol. Its IUPAC name is (2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldecanoic acid.
| Compound Name | (2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldecanoic acid |
|---|---|
| PubChem CID | 135016301 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldecanoic acid |
| SMILES | CCCCCC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C18H38O3Si/c1-9-10-11-12-13-14(2)16(15(3)17(19)20)21-22(7,8)18(4,5)6/h14-16H,9-13H2,1-8H3,(H,19,20)/t14-,15+,16+/m0/s1 |
| InChIKey | YSSPMILJMPISAG-ARFHVFGLSA-N |
| XLogP | 5.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|