C18H38O3Si — CID 135016313
tert-butyl-[(3R,4R,5S)-4-(methoxymethoxy)-5-methylnon-1-en-3-yl]oxy-dimethylsilane (PubChem CID 135016313) has the molecular formula C18H38O3Si and a molecular weight of 330.59 g/mol. Its IUPAC name is tert-butyl-[(3R,4R,5S)-4-(methoxymethoxy)-5-methylnon-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R,5S)-4-(methoxymethoxy)-5-methylnon-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135016313 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | tert-butyl-[(3R,4R,5S)-4-(methoxymethoxy)-5-methylnon-1-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OCOC)[C@@H](C)CCCC |
| InChI | InChI=1S/C18H38O3Si/c1-10-12-13-15(3)17(20-14-19-7)16(11-2)21-22(8,9)18(4,5)6/h11,15-17H,2,10,12-14H2,1,3-9H3/t15-,16+,17+/m0/s1 |
| InChIKey | PCTSSIUOTPYHNK-GVDBMIGSSA-N |
| XLogP | 5.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|