C26H48O3Si2 — CID 135016487
[(1S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-1,5,5,8a-tetramethyl-4a-trimethylsilyloxy-4,6,7,8-tetrahydronaphthalen-2-yl]methanol (PubChem CID 135016487) has the molecular formula C26H48O3Si2 and a molecular weight of 464.84 g/mol. Its IUPAC name is [(1S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-1,5,5,8a-tetramethyl-4a-trimethylsilyloxy-4,6,7,8-tetrahydronaphthalen-2-yl]methanol.
| Compound Name | [(1S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-1,5,5,8a-tetramethyl-4a-trimethylsilyloxy-4,6,7,8-tetrahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 135016487 |
| Molecular Formula | C26H48O3Si2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | [(1S,4aS,6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-1,5,5,8a-tetramethyl-4a-trimethylsilyloxy-4,6,7,8-tetrahydronaphthalen-2-yl]methanol |
| SMILES | C#C[C@@]1(C)C(CO)=CC[C@@]2(O[Si](C)(C)C)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C26H48O3Si2/c1-14-24(7)20(19-27)15-18-26(29-30(9,10)11)23(5,6)21(16-17-25(24,26)8)28-31(12,13)22(2,3)4/h1,15,21,27H,16-19H2,2-13H3/t21-,24-,25+,26+/m0/s1 |
| InChIKey | HXBVBIZQCSVIDC-DTGGKOQTSA-N |
| XLogP | 6.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|