C21H12F6O5 — CID 135016564
[phenyl-(5-phenylfuran-2-yl)-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate (PubChem CID 135016564) has the molecular formula C21H12F6O5 and a molecular weight of 458.31 g/mol. Its IUPAC name is [phenyl-(5-phenylfuran-2-yl)-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate.
| Compound Name | [phenyl-(5-phenylfuran-2-yl)-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 135016564 |
| Molecular Formula | C21H12F6O5 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | [phenyl-(5-phenylfuran-2-yl)-(2,2,2-trifluoroacetyl)oxymethyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(OC(=O)C(F)(F)F)(c1ccccc1)c1ccc(-c2ccccc2)o1)C(F)(F)F |
| InChI | InChI=1S/C21H12F6O5/c22-20(23,24)17(28)31-19(14-9-5-2-6-10-14,32-18(29)21(25,26)27)16-12-11-15(30-16)13-7-3-1-4-8-13/h1-12H |
| InChIKey | IIZJXIAQHJZXQZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|