C10H17BrO2 — CID 135016573
methyl 2-[(1R,2S)-2-(bromomethyl)cyclohexyl]acetate (PubChem CID 135016573) has the molecular formula C10H17BrO2 and a molecular weight of 249.15 g/mol. Its IUPAC name is methyl 2-[(1R,2S)-2-(bromomethyl)cyclohexyl]acetate.
| Compound Name | methyl 2-[(1R,2S)-2-(bromomethyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 135016573 |
| Molecular Formula | C10H17BrO2 |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | methyl 2-[(1R,2S)-2-(bromomethyl)cyclohexyl]acetate |
| SMILES | COC(=O)C[C@H]1CCCC[C@@H]1CBr |
| InChI | InChI=1S/C10H17BrO2/c1-13-10(12)6-8-4-2-3-5-9(8)7-11/h8-9H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | VRMSOQYVCNYNDV-RKDXNWHRSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|