About 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one
3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 135016755) has the molecular formula C15H11F2NO2
and a molecular weight of 275.25 g/mol. Its IUPAC name is 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one |
| PubChem CID | 135016755 |
| Molecular Formula | C15H11F2NO2 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1ccccc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11F2NO2/c16-12-6-5-10(9-13(12)17)11-3-1-2-4-14(11)18-7-8-20-15(18)19/h1-6,9H,7-8H2 |
| InChIKey | LCGMPMIIOJUKEE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one (CID 135016755) is 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one is O=C1OCCN1c1ccccc1-c1ccc(F)c(F)c1.
What is the InChIKey of 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one?
The InChIKey is LCGMPMIIOJUKEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2NO2/c16-12-6-5-10(9-13(12)17)11-3-1-2-4-14(11)18-7-8-20-15(18)19/h1-6,9H,7-8H2.
What are the key properties of 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one?
3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one has a molecular weight of 275.25 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-difluorophenyl)phenyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 135016755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).