C28H30N2O — CID 135016842
[7,7-dimethyl-2-(pyridin-2-ylmethylimino)-1-bicyclo[2.2.1]heptanyl]-diphenylmethanol (PubChem CID 135016842) has the molecular formula C28H30N2O and a molecular weight of 410.56 g/mol. Its IUPAC name is [7,7-dimethyl-2-(pyridin-2-ylmethylimino)-1-bicyclo[2.2.1]heptanyl]-diphenylmethanol.
| Compound Name | [7,7-dimethyl-2-(pyridin-2-ylmethylimino)-1-bicyclo[2.2.1]heptanyl]-diphenylmethanol |
|---|---|
| PubChem CID | 135016842 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | [7,7-dimethyl-2-(pyridin-2-ylmethylimino)-1-bicyclo[2.2.1]heptanyl]-diphenylmethanol |
| SMILES | CC1(C)C2CCC1(C(O)(c1ccccc1)c1ccccc1)/C(=N/Cc1ccccn1)C2 |
| InChI | InChI=1S/C28H30N2O/c1-26(2)23-16-17-27(26,25(19-23)30-20-24-15-9-10-18-29-24)28(31,21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-15,18,23,31H,16-17,19-20H2,1-2H3/b30-25+ |
| InChIKey | RFMWZCAPLHJBCR-QCWLDUFUSA-N |
| XLogP | 5.78 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|