C19H19NO3S — CID 135017046
(4S)-4-benzyl-3-(2-phenylsulfanylpropanoyl)-1,3-oxazolidin-2-one (PubChem CID 135017046) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(2-phenylsulfanylpropanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(2-phenylsulfanylpropanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135017046 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (4S)-4-benzyl-3-(2-phenylsulfanylpropanoyl)-1,3-oxazolidin-2-one |
| SMILES | CC(Sc1ccccc1)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H19NO3S/c1-14(24-17-10-6-3-7-11-17)18(21)20-16(13-23-19(20)22)12-15-8-4-2-5-9-15/h2-11,14,16H,12-13H2,1H3/t14?,16-/m0/s1 |
| InChIKey | RSYWWZYUMJZWLD-WMCAAGNKSA-N |
| XLogP | 3.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |