C13H20O3 — CID 135017070
(1R,3R,8R,10R,14Z)-2,7,11-trioxatricyclo[8.6.0.03,8]hexadec-14-ene (PubChem CID 135017070) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (1R,3R,8R,10R,14Z)-2,7,11-trioxatricyclo[8.6.0.03,8]hexadec-14-ene.
| Compound Name | (1R,3R,8R,10R,14Z)-2,7,11-trioxatricyclo[8.6.0.03,8]hexadec-14-ene |
|---|---|
| PubChem CID | 135017070 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (1R,3R,8R,10R,14Z)-2,7,11-trioxatricyclo[8.6.0.03,8]hexadec-14-ene |
| SMILES | C1=C\C[C@H]2O[C@@H]3CCCO[C@@H]3C[C@H]2OCC/1 |
| InChI | InChI=1S/C13H20O3/c1-2-5-10-12(14-7-3-1)9-13-11(16-10)6-4-8-15-13/h1-2,10-13H,3-9H2/b2-1-/t10-,11-,12-,13-/m1/s1 |
| InChIKey | NHOHKJPUQRWTOV-LVEPBNOGSA-N |
| XLogP | 2.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|