About methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate
methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate (PubChem CID 135017100) has the molecular formula C7H7BrCl3NO4
and a molecular weight of 355.40 g/mol. Its IUPAC name is methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate.
Molecular Properties
| Compound Name | methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate |
| PubChem CID | 135017100 |
| Molecular Formula | C7H7BrCl3NO4 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 352.86 |
| IUPAC Name | methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate |
| SMILES | COC(=O)C(=CBr)NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H7BrCl3NO4/c1-15-5(13)4(2-8)12-6(14)16-3-7(9,10)11/h2H,3H2,1H3,(H,12,14) |
| InChIKey | ORLQTOTYFKNNMV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate?
The IUPAC name of methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate (CID 135017100) is methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate.
What is the SMILES notation for methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate?
The canonical SMILES for methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate is COC(=O)C(=CBr)NC(=O)OCC(Cl)(Cl)Cl.
What is the InChIKey of methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate?
The InChIKey is ORLQTOTYFKNNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrCl3NO4/c1-15-5(13)4(2-8)12-6(14)16-3-7(9,10)11/h2H,3H2,1H3,(H,12,14).
What are the key properties of methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate?
methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate has a molecular weight of 355.40 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-2-(2,2,2-trichloroethoxycarbonylamino)prop-2-enoate is sourced from PubChem (CID 135017100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).