C13H20O8 — CID 135017172
(4R,4aS,7R,7aR)-7-methoxy-4-[(4R)-2-methoxy-1,3-dioxolan-4-yl]-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (PubChem CID 135017172) has the molecular formula C13H20O8 and a molecular weight of 304.30 g/mol. Its IUPAC name is (4R,4aS,7R,7aR)-7-methoxy-4-[(4R)-2-methoxy-1,3-dioxolan-4-yl]-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
| Compound Name | (4R,4aS,7R,7aR)-7-methoxy-4-[(4R)-2-methoxy-1,3-dioxolan-4-yl]-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 135017172 |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (4R,4aS,7R,7aR)-7-methoxy-4-[(4R)-2-methoxy-1,3-dioxolan-4-yl]-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
| SMILES | COC1OC[C@H]([C@H]2OC(C)(C)O[C@@H]3[C@H]2OC(=O)[C@@H]3OC)O1 |
| InChI | InChI=1S/C13H20O8/c1-13(2)20-7(6-5-17-12(16-4)18-6)8-9(21-13)10(15-3)11(14)19-8/h6-10,12H,5H2,1-4H3/t6-,7-,8+,9-,10-,12?/m1/s1 |
| InChIKey | AJGQBLVNLRDBGF-HDFDJLHMSA-N |
| XLogP | -0.21 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |