C23H39NO5 — CID 135017289
(2S,3S)-3-[(2S,3S,4S)-1-benzyl-3,4-bis[(2-methylpropan-2-yl)oxy]pyrrolidin-2-yl]butane-1,2,4-triol (PubChem CID 135017289) has the molecular formula C23H39NO5 and a molecular weight of 409.57 g/mol. Its IUPAC name is (2S,3S)-3-[(2S,3S,4S)-1-benzyl-3,4-bis[(2-methylpropan-2-yl)oxy]pyrrolidin-2-yl]butane-1,2,4-triol.
| Compound Name | (2S,3S)-3-[(2S,3S,4S)-1-benzyl-3,4-bis[(2-methylpropan-2-yl)oxy]pyrrolidin-2-yl]butane-1,2,4-triol |
|---|---|
| PubChem CID | 135017289 |
| Molecular Formula | C23H39NO5 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | (2S,3S)-3-[(2S,3S,4S)-1-benzyl-3,4-bis[(2-methylpropan-2-yl)oxy]pyrrolidin-2-yl]butane-1,2,4-triol |
| SMILES | CC(C)(C)O[C@H]1[C@H]([C@@H](CO)[C@H](O)CO)N(Cc2ccccc2)C[C@@H]1OC(C)(C)C |
| InChI | InChI=1S/C23H39NO5/c1-22(2,3)28-19-13-24(12-16-10-8-7-9-11-16)20(17(14-25)18(27)15-26)21(19)29-23(4,5)6/h7-11,17-21,25-27H,12-15H2,1-6H3/t17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | NPVCBLFQDCZTBK-HGJUEJDCSA-N |
| XLogP | 2.20 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |