C24H49NO4Si2 — CID 135017299
tert-butyl (2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 135017299) has the molecular formula C24H49NO4Si2 and a molecular weight of 471.83 g/mol. Its IUPAC name is tert-butyl (2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135017299 |
| Molecular Formula | C24H49NO4Si2 |
| Molecular Weight | 471.83 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | tert-butyl (2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H49NO4Si2/c1-15-16-18-20(29-31(13,14)24(8,9)10)19(28-30(11,12)23(5,6)7)17-25(18)21(26)27-22(2,3)4/h15,18-20H,1,16-17H2,2-14H3/t18-,19-,20+/m1/s1 |
| InChIKey | UHIGDRUTVOMMKC-AQNXPRMDSA-N |
| XLogP | 6.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.83 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|