C33H35NO8 — CID 135017326
methyl (2R,3S,4R)-8-nitro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,7,8a-hexahydrochromene-8-carboxylate (PubChem CID 135017326) has the molecular formula C33H35NO8 and a molecular weight of 573.64 g/mol. Its IUPAC name is methyl (2R,3S,4R)-8-nitro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,7,8a-hexahydrochromene-8-carboxylate.
| Compound Name | methyl (2R,3S,4R)-8-nitro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,7,8a-hexahydrochromene-8-carboxylate |
|---|---|
| PubChem CID | 135017326 |
| Molecular Formula | C33H35NO8 |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | methyl (2R,3S,4R)-8-nitro-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,7,8a-hexahydrochromene-8-carboxylate |
| SMILES | COC(=O)C1([N+](=O)[O-])CC=CC2C1O[C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C33H35NO8/c1-38-32(35)33(34(36)37)19-11-18-27-29(40-21-25-14-7-3-8-15-25)30(41-22-26-16-9-4-10-17-26)28(42-31(27)33)23-39-20-24-12-5-2-6-13-24/h2-18,27-31H,19-23H2,1H3/t27?,28-,29-,30-,31?,33?/m1/s1 |
| InChIKey | JVZBPAHJZARNSN-FUTVCWQBSA-N |
| XLogP | 4.91 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|