C17H27NOSi — CID 135017340
tert-butyl-dimethyl-[[(2S)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]methoxy]silane (PubChem CID 135017340) has the molecular formula C17H27NOSi and a molecular weight of 289.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 135017340 |
| Molecular Formula | C17H27NOSi |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S)-5-phenyl-3,4-dihydro-2H-pyrrol-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C17H27NOSi/c1-17(2,3)20(4,5)19-13-15-11-12-16(18-15)14-9-7-6-8-10-14/h6-10,15H,11-13H2,1-5H3/t15-/m0/s1 |
| InChIKey | MQUJJRNRXHVBIN-HNNXBMFYSA-N |
| XLogP | 4.66 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|