C20H28O6 — CID 135017384
diethyl 4-ethenyl-5,7-dimethoxy-3,4,4a,8a-tetrahydro-1H-naphthalene-2,2-dicarboxylate (PubChem CID 135017384) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is diethyl 4-ethenyl-5,7-dimethoxy-3,4,4a,8a-tetrahydro-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | diethyl 4-ethenyl-5,7-dimethoxy-3,4,4a,8a-tetrahydro-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135017384 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | diethyl 4-ethenyl-5,7-dimethoxy-3,4,4a,8a-tetrahydro-1H-naphthalene-2,2-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OCC)(C(=O)OCC)CC2C=C(OC)C=C(OC)C12 |
| InChI | InChI=1S/C20H28O6/c1-6-13-11-20(18(21)25-7-2,19(22)26-8-3)12-14-9-15(23-4)10-16(24-5)17(13)14/h6,9-10,13-14,17H,1,7-8,11-12H2,2-5H3 |
| InChIKey | NLGFWTGZMNUQSM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|