C11H16O3 — CID 135017456
(1R,3R,8R,10R)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradec-5-ene (PubChem CID 135017456) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1R,3R,8R,10R)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradec-5-ene.
| Compound Name | (1R,3R,8R,10R)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradec-5-ene |
|---|---|
| PubChem CID | 135017456 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1R,3R,8R,10R)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradec-5-ene |
| SMILES | C1=CO[C@@H]2C[C@H]3OCCC[C@H]3O[C@@H]2C1 |
| InChI | InChI=1S/C11H16O3/c1-3-8-10(12-5-1)7-11-9(14-8)4-2-6-13-11/h1,5,8-11H,2-4,6-7H2/t8-,9-,10-,11-/m1/s1 |
| InChIKey | VTEMOKXKLRERDY-GWOFURMSSA-N |
| XLogP | 1.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |