C16H9FN4O3 — CID 135017584
5-(4-fluorophenyl)-[1,3,5]triazino[1,2-a]quinazoline-1,3,6-trione (PubChem CID 135017584) has the molecular formula C16H9FN4O3 and a molecular weight of 324.27 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-[1,3,5]triazino[1,2-a]quinazoline-1,3,6-trione.
| Compound Name | 5-(4-fluorophenyl)-[1,3,5]triazino[1,2-a]quinazoline-1,3,6-trione |
|---|---|
| PubChem CID | 135017584 |
| Molecular Formula | C16H9FN4O3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 5-(4-fluorophenyl)-[1,3,5]triazino[1,2-a]quinazoline-1,3,6-trione |
| SMILES | O=c1nc2n(-c3ccc(F)cc3)c(=O)c3ccccc3n2c(=O)[nH]1 |
| InChI | InChI=1S/C16H9FN4O3/c17-9-5-7-10(8-6-9)20-13(22)11-3-1-2-4-12(11)21-15(20)18-14(23)19-16(21)24/h1-8H,(H,19,23,24) |
| InChIKey | PAPNONPPVSYZDF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|