C24H26N2O2 — CID 135017627
benzyl (1R,12R)-16-ethyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene-15-carboxylate (PubChem CID 135017627) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is benzyl (1R,12R)-16-ethyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene-15-carboxylate.
| Compound Name | benzyl (1R,12R)-16-ethyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene-15-carboxylate |
|---|---|
| PubChem CID | 135017627 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | benzyl (1R,12R)-16-ethyl-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene-15-carboxylate |
| SMILES | CCC1[C@@H]2CCN(C(=O)OCc3ccccc3)[C@H]1c1c([nH]c3ccccc13)C2 |
| InChI | InChI=1S/C24H26N2O2/c1-2-18-17-12-13-26(24(27)28-15-16-8-4-3-5-9-16)23(18)22-19-10-6-7-11-20(19)25-21(22)14-17/h3-11,17-18,23,25H,2,12-15H2,1H3/t17-,18?,23-/m1/s1 |
| InChIKey | KZPHYAZOBAAROG-JIUDAOPXSA-N |
| XLogP | 5.45 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|