C29H61NO7Si2 — CID 135017743
tert-butyl N-[(3R,4S,5R,6S)-2,4-dihydroxy-5-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]carbamate (PubChem CID 135017743) has the molecular formula C29H61NO7Si2 and a molecular weight of 591.98 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S,5R,6S)-2,4-dihydroxy-5-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S,5R,6S)-2,4-dihydroxy-5-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 135017743 |
| Molecular Formula | C29H61NO7Si2 |
| Molecular Weight | 591.98 g/mol |
| Exact Mass | 591.40 |
| IUPAC Name | tert-butyl N-[(3R,4S,5R,6S)-2,4-dihydroxy-5-tri(propan-2-yl)silyloxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl]carbamate |
| SMILES | CC(C)[Si](OC[C@@H]1OC(O)[C@H](NC(=O)OC(C)(C)C)[C@H](O)[C@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H61NO7Si2/c1-17(2)38(18(3)4,19(5)6)34-16-23-26(37-39(20(7)8,21(9)10)22(11)12)25(31)24(27(32)35-23)30-28(33)36-29(13,14)15/h17-27,31-32H,16H2,1-15H3,(H,30,33)/t23-,24+,25-,26-,27?/m0/s1 |
| InChIKey | YGBKSSJTEIROJJ-OPYWFVRGSA-N |
| XLogP | 6.71 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.98 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|