C14H15NO3 — CID 135017856
(1S,6R,8R)-2-benzylidene-1,6-dihydroxy-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 135017856) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (1S,6R,8R)-2-benzylidene-1,6-dihydroxy-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (1S,6R,8R)-2-benzylidene-1,6-dihydroxy-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 135017856 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (1S,6R,8R)-2-benzylidene-1,6-dihydroxy-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | O=C1C(=Cc2ccccc2)[C@H](O)[C@H]2C[C@@H](O)CN12 |
| InChI | InChI=1S/C14H15NO3/c16-10-7-12-13(17)11(14(18)15(12)8-10)6-9-4-2-1-3-5-9/h1-6,10,12-13,16-17H,7-8H2/t10-,12-,13+/m1/s1 |
| InChIKey | HXXAIWIXVNUAJD-RTXFEEFZSA-N |
| XLogP | 0.41 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|